C21H23N3O4 — CID 8935859
N-[2-(4-methoxyphenoxy)ethyl]-3-(3-methyl-4-oxoquinazolin-2-yl)propanamide (PubChem CID 8935859) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is N-[2-(4-methoxyphenoxy)ethyl]-3-(3-methyl-4-oxoquinazolin-2-yl)propanamide.
| Compound Name | N-[2-(4-methoxyphenoxy)ethyl]-3-(3-methyl-4-oxoquinazolin-2-yl)propanamide |
|---|---|
| PubChem CID | 8935859 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[2-(4-methoxyphenoxy)ethyl]-3-(3-methyl-4-oxoquinazolin-2-yl)propanamide |
| SMILES | COc1ccc(OCCNC(=O)CCc2nc3ccccc3c(=O)n2C)cc1 |
| InChI | InChI=1S/C21H23N3O4/c1-24-19(23-18-6-4-3-5-17(18)21(24)26)11-12-20(25)22-13-14-28-16-9-7-15(27-2)8-10-16/h3-10H,11-14H2,1-2H3,(H,22,25) |
| InChIKey | HILWAGWSDTYZJG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|