C21H32O2 — CID 89358679
(1S,8R,11S,12S,13R,14S)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyltetracyclo[6.5.1.11,5.05,14]pentadecan-4-one (PubChem CID 89358679) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (1S,8R,11S,12S,13R,14S)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyltetracyclo[6.5.1.11,5.05,14]pentadecan-4-one.
| Compound Name | (1S,8R,11S,12S,13R,14S)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyltetracyclo[6.5.1.11,5.05,14]pentadecan-4-one |
|---|---|
| PubChem CID | 89358679 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (1S,8R,11S,12S,13R,14S)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyltetracyclo[6.5.1.11,5.05,14]pentadecan-4-one |
| SMILES | C=C[C@]1(C)CC[C@]2(C)C(C)CC34C[C@@](CCC3=O)([C@@H]42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C21H32O2/c1-6-18(4)9-10-19(5)13(2)11-21-12-20(17(19)21,8-7-15(21)22)14(3)16(18)23/h6,13-14,16-17,23H,1,7-12H2,2-5H3/t13?,14-,16-,17-,18+,19+,20+,21?/m0/s1 |
| InChIKey | OJMXRRMLYHSCKG-KYVMEIJZSA-N |
| XLogP | 4.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|