About (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde
(2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde (PubChem CID 89359147) has the molecular formula C5H9NO2
and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde.
Molecular Properties
| Compound Name | (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde |
| PubChem CID | 89359147 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde |
| SMILES | C[C@H]1NC[C@H](C=O)O1 |
| InChI | InChI=1S/C5H9NO2/c1-4-6-2-5(3-7)8-4/h3-6H,2H2,1H3/t4-,5+/m0/s1 |
| InChIKey | DHGCLNZPJIWEKZ-CRCLSJGQSA-N |
| XLogP | -0.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde?
The IUPAC name of (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde (CID 89359147) is (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde.
What is the SMILES notation for (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde?
The canonical SMILES for (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde is C[C@H]1NC[C@H](C=O)O1.
What is the InChIKey of (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde?
The InChIKey is DHGCLNZPJIWEKZ-CRCLSJGQSA-N. The full InChI is InChI=1S/C5H9NO2/c1-4-6-2-5(3-7)8-4/h3-6H,2H2,1H3/t4-,5+/m0/s1.
What are the key properties of (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde?
(2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde has a molecular weight of 115.13 g/mol, XLogP of -0.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,5R)-2-methyl-1,3-oxazolidine-5-carbaldehyde is sourced from PubChem (CID 89359147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).