C29H35N7O — CID 89359152
(3R)-1-[4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol (PubChem CID 89359152) has the molecular formula C29H35N7O and a molecular weight of 497.65 g/mol. Its IUPAC name is (3R)-1-[4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol.
| Compound Name | (3R)-1-[4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol |
|---|---|
| PubChem CID | 89359152 |
| Molecular Formula | C29H35N7O |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.29 |
| IUPAC Name | (3R)-1-[4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]butyl]piperidin-3-ol |
| SMILES | Nc1cc(-c2cc(CCCCN3CCC[C@@H](O)C3)n3ncnc(N)c23)ccc1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C29H35N7O/c30-27-15-22(11-12-23(27)18-32-17-21-7-2-1-3-8-21)26-16-24(36-28(26)29(31)33-20-34-36)9-4-5-13-35-14-6-10-25(37)19-35/h1-3,7-8,11-12,15-16,18,20,25,37H,4-6,9-10,13-14,17,19,30H2,(H2,31,33,34)/b32-18+/t25-/m1/s1 |
| InChIKey | BZBOGLCRYGDFNJ-PXFLCDOESA-N |
| XLogP | 3.96 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|