C10H11Cl2NO — CID 89359215
(3E,5E,7E)-5,8-dichloro-1-imino-3-methylnona-3,5,7-trien-2-one (PubChem CID 89359215) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is (3E,5E,7E)-5,8-dichloro-1-imino-3-methylnona-3,5,7-trien-2-one.
| Compound Name | (3E,5E,7E)-5,8-dichloro-1-imino-3-methylnona-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 89359215 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | (3E,5E,7E)-5,8-dichloro-1-imino-3-methylnona-3,5,7-trien-2-one |
| SMILES | [H]/N=C/C(=O)/C(C)=C/C(Cl)=C\C=C(/C)Cl |
| InChI | InChI=1S/C10H11Cl2NO/c1-7(10(14)6-13)5-9(12)4-3-8(2)11/h3-6,13H,1-2H3/b7-5+,8-3+,9-4+,13-6+ |
| InChIKey | UVYXXLYRLPWVLC-AVODHHKFSA-N |
| XLogP | 3.42 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|