C29H43NO6 — CID 89359282
[(1S,8R,9R,11S,12S,13R,14R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] N-cyclohexyloxycarbonylcarbamate (PubChem CID 89359282) has the molecular formula C29H43NO6 and a molecular weight of 501.66 g/mol. Its IUPAC name is [(1S,8R,9R,11S,12S,13R,14R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] N-cyclohexyloxycarbonylcarbamate.
| Compound Name | [(1S,8R,9R,11S,12S,13R,14R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] N-cyclohexyloxycarbonylcarbamate |
|---|---|
| PubChem CID | 89359282 |
| Molecular Formula | C29H43NO6 |
| Molecular Weight | 501.66 g/mol |
| Exact Mass | 501.31 |
| IUPAC Name | [(1S,8R,9R,11S,12S,13R,14R)-11-ethenyl-12-hydroxy-7,8,11,13-tetramethyl-4-oxo-9-tetracyclo[6.5.1.11,5.05,14]pentadecanyl] N-cyclohexyloxycarbonylcarbamate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)NC(=O)OC2CCCCC2)[C@]2(C)C(C)CC34C[C@@](CCC3=O)([C@@H]42)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C29H43NO6/c1-6-26(4)15-21(36-25(34)30-24(33)35-19-10-8-7-9-11-19)27(5)17(2)14-29-16-28(23(27)29,13-12-20(29)31)18(3)22(26)32/h6,17-19,21-23,32H,1,7-16H2,2-5H3,(H,30,33,34)/t17?,18-,21+,22-,23-,26+,27-,28+,29?/m0/s1 |
| InChIKey | JSQNGWBQFSYOOH-MAQWBYHTSA-N |
| XLogP | 5.55 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|