About butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate
butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate (PubChem CID 89359740) has the molecular formula C13H24O3
and a molecular weight of 228.33 g/mol. Its IUPAC name is butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate.
Molecular Properties
| Compound Name | butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate |
| PubChem CID | 89359740 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate |
| SMILES | CC/C=C(\C)[C@H](O)C(C)C(=O)OCCCC |
| InChI | InChI=1S/C13H24O3/c1-5-7-9-16-13(15)11(4)12(14)10(3)8-6-2/h8,11-12,14H,5-7,9H2,1-4H3/b10-8+/t11?,12-/m0/s1 |
| InChIKey | NIDLSPOQUOBCMG-ARCOSFKQSA-N |
| XLogP | 2.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate?
The IUPAC name of butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate (CID 89359740) is butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate.
What is the SMILES notation for butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate?
The canonical SMILES for butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate is CC/C=C(\C)[C@H](O)C(C)C(=O)OCCCC.
What is the InChIKey of butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate?
The InChIKey is NIDLSPOQUOBCMG-ARCOSFKQSA-N. The full InChI is InChI=1S/C13H24O3/c1-5-7-9-16-13(15)11(4)12(14)10(3)8-6-2/h8,11-12,14H,5-7,9H2,1-4H3/b10-8+/t11?,12-/m0/s1.
What are the key properties of butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate?
butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate has a molecular weight of 228.33 g/mol, XLogP of 2.68, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (E,3R)-3-hydroxy-2,4-dimethylhept-4-enoate is sourced from PubChem (CID 89359740), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).