About (3R,4S)-3,4-diazidothiolane
(3R,4S)-3,4-diazidothiolane (PubChem CID 89359804) has the molecular formula C4H6N6S
and a molecular weight of 170.20 g/mol. Its IUPAC name is (3R,4S)-3,4-diazidothiolane.
Molecular Properties
| Compound Name | (3R,4S)-3,4-diazidothiolane |
| PubChem CID | 89359804 |
| Molecular Formula | C4H6N6S |
| Molecular Weight | 170.20 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | (3R,4S)-3,4-diazidothiolane |
| SMILES | [N-]=[N+]=N[C@H]1CSC[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C4H6N6S/c5-9-7-3-1-11-2-4(3)8-10-6/h3-4H,1-2H2/t3-,4+ |
| InChIKey | LTLZOVCDDGGXEG-ZXZARUISSA-N |
| XLogP | 2.09 |
| TPSA | 97.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-3,4-diazidothiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-3,4-diazidothiolane?
The IUPAC name of (3R,4S)-3,4-diazidothiolane (CID 89359804) is (3R,4S)-3,4-diazidothiolane.
What is the SMILES notation for (3R,4S)-3,4-diazidothiolane?
The canonical SMILES for (3R,4S)-3,4-diazidothiolane is [N-]=[N+]=N[C@H]1CSC[C@H]1N=[N+]=[N-].
What is the InChIKey of (3R,4S)-3,4-diazidothiolane?
The InChIKey is LTLZOVCDDGGXEG-ZXZARUISSA-N. The full InChI is InChI=1S/C4H6N6S/c5-9-7-3-1-11-2-4(3)8-10-6/h3-4H,1-2H2/t3-,4+.
What are the key properties of (3R,4S)-3,4-diazidothiolane?
(3R,4S)-3,4-diazidothiolane has a molecular weight of 170.20 g/mol, XLogP of 2.09, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-3,4-diazidothiolane is sourced from PubChem (CID 89359804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).