About 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene
6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene (PubChem CID 89359895) has the molecular formula C11H15BrO2
and a molecular weight of 259.14 g/mol. Its IUPAC name is 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene.
Molecular Properties
| Compound Name | 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene |
| PubChem CID | 89359895 |
| Molecular Formula | C11H15BrO2 |
| Molecular Weight | 259.14 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene |
| SMILES | CCOC(OCC)C1=CC=C=CC1Br |
| InChI | InChI=1S/C11H15BrO2/c1-3-13-11(14-4-2)9-7-5-6-8-10(9)12/h5,7-8,10-11H,3-4H2,1-2H3 |
| InChIKey | OKSRHQGJDMFWOR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.14 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene?
The IUPAC name of 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene (CID 89359895) is 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene.
What is the SMILES notation for 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene?
The canonical SMILES for 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene is CCOC(OCC)C1=CC=C=CC1Br.
What is the InChIKey of 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene?
The InChIKey is OKSRHQGJDMFWOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO2/c1-3-13-11(14-4-2)9-7-5-6-8-10(9)12/h5,7-8,10-11H,3-4H2,1-2H3.
What are the key properties of 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene?
6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene has a molecular weight of 259.14 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-5-(diethoxymethyl)cyclohexa-1,2,4-triene is sourced from PubChem (CID 89359895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).