About 2,3-diethylfuro[2,3-b]pyridine
2,3-diethylfuro[2,3-b]pyridine (PubChem CID 89359925) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,3-diethylfuro[2,3-b]pyridine.
Molecular Properties
| Compound Name | 2,3-diethylfuro[2,3-b]pyridine |
| PubChem CID | 89359925 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 2,3-diethylfuro[2,3-b]pyridine |
| SMILES | CCc1oc2ncccc2c1CC |
| InChI | InChI=1S/C11H13NO/c1-3-8-9-6-5-7-12-11(9)13-10(8)4-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | OZUWHLJNGNBLNV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,3-diethylfuro[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diethylfuro[2,3-b]pyridine?
The IUPAC name of 2,3-diethylfuro[2,3-b]pyridine (CID 89359925) is 2,3-diethylfuro[2,3-b]pyridine.
What is the SMILES notation for 2,3-diethylfuro[2,3-b]pyridine?
The canonical SMILES for 2,3-diethylfuro[2,3-b]pyridine is CCc1oc2ncccc2c1CC.
What is the InChIKey of 2,3-diethylfuro[2,3-b]pyridine?
The InChIKey is OZUWHLJNGNBLNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-3-8-9-6-5-7-12-11(9)13-10(8)4-2/h5-7H,3-4H2,1-2H3.
What are the key properties of 2,3-diethylfuro[2,3-b]pyridine?
2,3-diethylfuro[2,3-b]pyridine has a molecular weight of 175.23 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diethylfuro[2,3-b]pyridine is sourced from PubChem (CID 89359925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).