C31H42IN7O — CID 89359948
4-N-cycloheptyl-6-N-[3-(iodomethyl)-4-phenylmethoxyphenyl]-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 89359948) has the molecular formula C31H42IN7O and a molecular weight of 655.63 g/mol. Its IUPAC name is 4-N-cycloheptyl-6-N-[3-(iodomethyl)-4-phenylmethoxyphenyl]-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-cycloheptyl-6-N-[3-(iodomethyl)-4-phenylmethoxyphenyl]-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 89359948 |
| Molecular Formula | C31H42IN7O |
| Molecular Weight | 655.63 g/mol |
| Exact Mass | 655.25 |
| IUPAC Name | 4-N-cycloheptyl-6-N-[3-(iodomethyl)-4-phenylmethoxyphenyl]-2-N-methyl-2-N-(1-methylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CN1CCC(N(C)c2nc(Nc3ccc(OCc4ccccc4)c(CI)c3)nc(NC3CCCCCC3)n2)CC1 |
| InChI | InChI=1S/C31H42IN7O/c1-38-18-16-27(17-19-38)39(2)31-36-29(33-25-12-8-3-4-9-13-25)35-30(37-31)34-26-14-15-28(24(20-26)21-32)40-22-23-10-6-5-7-11-23/h5-7,10-11,14-15,20,25,27H,3-4,8-9,12-13,16-19,21-22H2,1-2H3,(H2,33,34,35,36,37) |
| InChIKey | YNCOKVWSDPKYKI-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 78.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|