C21H17F12N — CID 89359949
1-(9,9a-dihydro-4aH-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-methylheptan-1-amine (PubChem CID 89359949) has the molecular formula C21H17F12N and a molecular weight of 511.35 g/mol. Its IUPAC name is 1-(9,9a-dihydro-4aH-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-methylheptan-1-amine.
| Compound Name | 1-(9,9a-dihydro-4aH-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-methylheptan-1-amine |
|---|---|
| PubChem CID | 89359949 |
| Molecular Formula | C21H17F12N |
| Molecular Weight | 511.35 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 1-(9,9a-dihydro-4aH-fluoren-2-yl)-2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoro-N-methylheptan-1-amine |
| SMILES | CNC(C1=CC2Cc3ccccc3C2C=C1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C21H17F12N/c1-34-15(11-6-7-14-12(9-11)8-10-4-2-3-5-13(10)14)17(24,25)19(28,29)21(32,33)20(30,31)18(26,27)16(22)23/h2-7,9,12,14-16,34H,8H2,1H3 |
| InChIKey | IJNFQVWIBYXNJH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|