About N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine
N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine (PubChem CID 89360277) has the molecular formula C8H18N2
and a molecular weight of 142.25 g/mol. Its IUPAC name is N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine.
Molecular Properties
| Compound Name | N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine |
| PubChem CID | 89360277 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine |
| SMILES | C/C=C\CCN(CC)CN |
| InChI | InChI=1S/C8H18N2/c1-3-5-6-7-10(4-2)8-9/h3,5H,4,6-9H2,1-2H3/b5-3- |
| InChIKey | CJBYKSONGZXTRT-HYXAFXHYSA-N |
| XLogP | 1.19 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine?
The IUPAC name of N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine (CID 89360277) is N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine.
What is the SMILES notation for N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine?
The canonical SMILES for N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine is C/C=C\CCN(CC)CN.
What is the InChIKey of N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine?
The InChIKey is CJBYKSONGZXTRT-HYXAFXHYSA-N. The full InChI is InChI=1S/C8H18N2/c1-3-5-6-7-10(4-2)8-9/h3,5H,4,6-9H2,1-2H3/b5-3-.
What are the key properties of N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine?
N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine has a molecular weight of 142.25 g/mol, XLogP of 1.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N'-[(Z)-pent-3-enyl]methanediamine is sourced from PubChem (CID 89360277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).