C19H18ClN3S — CID 89360354
3-[1-[[5-[(3-chlorophenyl)methyl]thiophen-2-yl]methylamino]ethenyl]pyridin-2-amine (PubChem CID 89360354) has the molecular formula C19H18ClN3S and a molecular weight of 355.89 g/mol. Its IUPAC name is 3-[1-[[5-[(3-chlorophenyl)methyl]thiophen-2-yl]methylamino]ethenyl]pyridin-2-amine.
| Compound Name | 3-[1-[[5-[(3-chlorophenyl)methyl]thiophen-2-yl]methylamino]ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 89360354 |
| Molecular Formula | C19H18ClN3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | 3-[1-[[5-[(3-chlorophenyl)methyl]thiophen-2-yl]methylamino]ethenyl]pyridin-2-amine |
| SMILES | C=C(NCc1ccc(Cc2cccc(Cl)c2)s1)c1cccnc1N |
| InChI | InChI=1S/C19H18ClN3S/c1-13(18-6-3-9-22-19(18)21)23-12-17-8-7-16(24-17)11-14-4-2-5-15(20)10-14/h2-10,23H,1,11-12H2,(H2,21,22) |
| InChIKey | UWMIVSYTJGTOKV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |