C28H18Cl2F7N3O — CID 89360564
N-[1-(5-chloro-2-pyridinyl)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide (PubChem CID 89360564) has the molecular formula C28H18Cl2F7N3O and a molecular weight of 616.36 g/mol. Its IUPAC name is N-[1-(5-chloro-2-pyridinyl)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide.
| Compound Name | N-[1-(5-chloro-2-pyridinyl)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide |
|---|---|
| PubChem CID | 89360564 |
| Molecular Formula | C28H18Cl2F7N3O |
| Molecular Weight | 616.36 g/mol |
| Exact Mass | 615.07 |
| IUPAC Name | N-[1-(5-chloro-2-pyridinyl)-1-[2-chloro-5-(trifluoromethyl)phenyl]-2-phenylethyl]-4-fluoro-3-(trifluoromethyl)benzohydrazide |
| SMILES | NN(C(=O)c1ccc(F)c(C(F)(F)F)c1)C(Cc1ccccc1)(c1ccc(Cl)cn1)c1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C28H18Cl2F7N3O/c29-19-8-11-24(39-15-19)26(14-16-4-2-1-3-5-16,20-13-18(27(32,33)34)7-9-22(20)30)40(38)25(41)17-6-10-23(31)21(12-17)28(35,36)37/h1-13,15H,14,38H2 |
| InChIKey | TULIQPPGMTVJPF-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.36 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|