C14H25N — CID 89360730
(4Z)-N-tert-butyl-2,2,5-trimethylhepta-4,6-dien-3-imine (PubChem CID 89360730) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (4Z)-N-tert-butyl-2,2,5-trimethylhepta-4,6-dien-3-imine.
| Compound Name | (4Z)-N-tert-butyl-2,2,5-trimethylhepta-4,6-dien-3-imine |
|---|---|
| PubChem CID | 89360730 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (4Z)-N-tert-butyl-2,2,5-trimethylhepta-4,6-dien-3-imine |
| SMILES | C=C/C(C)=C\C(=N/C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-9-11(2)10-12(13(3,4)5)15-14(6,7)8/h9-10H,1H2,2-8H3/b11-10-,15-12+ |
| InChIKey | RRLBNCCMOQKTDP-WTPCJXRQSA-N |
| XLogP | 4.40 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|