C31H20F3N3O5 — CID 89361126
3-[3-[(Z)-[1-(3,5-dimethylphenyl)-2-oxo-6-(trifluoromethyl)indol-3-ylidene]amino]-2-oxo-1,3-benzoxazol-7-yl]benzoic acid (PubChem CID 89361126) has the molecular formula C31H20F3N3O5 and a molecular weight of 571.51 g/mol. Its IUPAC name is 3-[3-[(Z)-[1-(3,5-dimethylphenyl)-2-oxo-6-(trifluoromethyl)indol-3-ylidene]amino]-2-oxo-1,3-benzoxazol-7-yl]benzoic acid.
| Compound Name | 3-[3-[(Z)-[1-(3,5-dimethylphenyl)-2-oxo-6-(trifluoromethyl)indol-3-ylidene]amino]-2-oxo-1,3-benzoxazol-7-yl]benzoic acid |
|---|---|
| PubChem CID | 89361126 |
| Molecular Formula | C31H20F3N3O5 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 3-[3-[(Z)-[1-(3,5-dimethylphenyl)-2-oxo-6-(trifluoromethyl)indol-3-ylidene]amino]-2-oxo-1,3-benzoxazol-7-yl]benzoic acid |
| SMILES | Cc1cc(C)cc(N2C(=O)/C(=N\n3c(=O)oc4c(-c5cccc(C(=O)O)c5)cccc43)c3ccc(C(F)(F)F)cc32)c1 |
| InChI | InChI=1S/C31H20F3N3O5/c1-16-11-17(2)13-21(12-16)36-25-15-20(31(32,33)34)9-10-23(25)26(28(36)38)35-37-24-8-4-7-22(27(24)42-30(37)41)18-5-3-6-19(14-18)29(39)40/h3-15H,1-2H3,(H,39,40)/b35-26- |
| InChIKey | SOADMKGEFABXFP-JYUHDHNASA-N |
| XLogP | 6.53 |
| TPSA | 105.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_isatin(189)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|