About (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide
(Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide (PubChem CID 89361275) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide |
| PubChem CID | 89361275 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide |
| SMILES | CC(=C/N)/C(N)=N/c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H17N3/c1-8-4-9(2)6-11(5-8)15-12(14)10(3)7-13/h4-7H,13H2,1-3H3,(H2,14,15)/b10-7- |
| InChIKey | HYQGQRNYVHRDFN-YFHOEESVSA-N |
| XLogP | 2.15 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide?
The IUPAC name of (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide (CID 89361275) is (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide.
What is the SMILES notation for (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide?
The canonical SMILES for (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide is CC(=C/N)/C(N)=N/c1cc(C)cc(C)c1.
What is the InChIKey of (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide?
The InChIKey is HYQGQRNYVHRDFN-YFHOEESVSA-N. The full InChI is InChI=1S/C12H17N3/c1-8-4-9(2)6-11(5-8)15-12(14)10(3)7-13/h4-7H,13H2,1-3H3,(H2,14,15)/b10-7-.
What are the key properties of (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide?
(Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide has a molecular weight of 203.29 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3-amino-N'-(3,5-dimethylphenyl)-2-methylprop-2-enimidamide is sourced from PubChem (CID 89361275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).