C23H26F2N2O — CID 89361375
N'-[(3Z,5E)-3-ethenyl-5-fluorohepta-3,5-dienyl]-3-fluoro-2-phenylmethoxycyclohexa-1,3-diene-1-carboximidamide (PubChem CID 89361375) has the molecular formula C23H26F2N2O and a molecular weight of 384.47 g/mol. Its IUPAC name is N'-[(3Z,5E)-3-ethenyl-5-fluorohepta-3,5-dienyl]-3-fluoro-2-phenylmethoxycyclohexa-1,3-diene-1-carboximidamide.
| Compound Name | N'-[(3Z,5E)-3-ethenyl-5-fluorohepta-3,5-dienyl]-3-fluoro-2-phenylmethoxycyclohexa-1,3-diene-1-carboximidamide |
|---|---|
| PubChem CID | 89361375 |
| Molecular Formula | C23H26F2N2O |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N'-[(3Z,5E)-3-ethenyl-5-fluorohepta-3,5-dienyl]-3-fluoro-2-phenylmethoxycyclohexa-1,3-diene-1-carboximidamide |
| SMILES | C=C/C(=C\C(F)=C/C)CC/N=C(\N)C1=C(OCc2ccccc2)C(F)=CCC1 |
| InChI | InChI=1S/C23H26F2N2O/c1-3-17(15-19(24)4-2)13-14-27-23(26)20-11-8-12-21(25)22(20)28-16-18-9-6-5-7-10-18/h3-7,9-10,12,15H,1,8,11,13-14,16H2,2H3,(H2,26,27)/b17-15+,19-4+ |
| InChIKey | JUGWBKSDDUZRMJ-HDKQYZBFSA-N |
| XLogP | 5.84 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|