About 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine
1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine (PubChem CID 89361435) has the molecular formula C9H14FN3
and a molecular weight of 183.23 g/mol. Its IUPAC name is 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine |
| PubChem CID | 89361435 |
| Molecular Formula | C9H14FN3 |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.12 |
| IUPAC Name | 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine |
| SMILES | C/C(=C/NC1=CCC(N)C=C1)NF |
| InChI | InChI=1S/C9H14FN3/c1-7(13-10)6-12-9-4-2-8(11)3-5-9/h2,4-6,8,12-13H,3,11H2,1H3/b7-6- |
| InChIKey | IXPFNHQRXACTSH-SREVYHEPSA-N |
| XLogP | 1.08 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine?
The IUPAC name of 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine (CID 89361435) is 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine.
What is the SMILES notation for 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine?
The canonical SMILES for 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine is C/C(=C/NC1=CCC(N)C=C1)NF.
What is the InChIKey of 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine?
The InChIKey is IXPFNHQRXACTSH-SREVYHEPSA-N. The full InChI is InChI=1S/C9H14FN3/c1-7(13-10)6-12-9-4-2-8(11)3-5-9/h2,4-6,8,12-13H,3,11H2,1H3/b7-6-.
What are the key properties of 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine?
1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine has a molecular weight of 183.23 g/mol, XLogP of 1.08, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-[(Z)-2-(fluoroamino)prop-1-enyl]cyclohexa-1,5-diene-1,4-diamine is sourced from PubChem (CID 89361435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).