C12H20N2 — CID 89361478
2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-3-yl]ethanamine (PubChem CID 89361478) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-3-yl]ethanamine.
| Compound Name | 2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-3-yl]ethanamine |
|---|---|
| PubChem CID | 89361478 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 2-[4-[(1Z,3Z)-penta-1,3-dienyl]-1,2,3,6-tetrahydropyridin-3-yl]ethanamine |
| SMILES | C/C=C\C=C/C1=CCNCC1CCN |
| InChI | InChI=1S/C12H20N2/c1-2-3-4-5-11-7-9-14-10-12(11)6-8-13/h2-5,7,12,14H,6,8-10,13H2,1H3/b3-2-,5-4- |
| InChIKey | KTUZBQRJDKCCGV-LDIADDGTSA-N |
| XLogP | 1.61 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|