C30H47ClN4O6 — CID 89361512
[(E,3S)-1-(6-chloro-9-methylpurin-2-yl)-2-methylpent-1-en-3-yl] (3S,6R,7S,8S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-5-oxotridecanoate (PubChem CID 89361512) has the molecular formula C30H47ClN4O6 and a molecular weight of 595.18 g/mol. Its IUPAC name is [(E,3S)-1-(6-chloro-9-methylpurin-2-yl)-2-methylpent-1-en-3-yl] (3S,6R,7S,8S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-5-oxotridecanoate.
| Compound Name | [(E,3S)-1-(6-chloro-9-methylpurin-2-yl)-2-methylpent-1-en-3-yl] (3S,6R,7S,8S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-5-oxotridecanoate |
|---|---|
| PubChem CID | 89361512 |
| Molecular Formula | C30H47ClN4O6 |
| Molecular Weight | 595.18 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | [(E,3S)-1-(6-chloro-9-methylpurin-2-yl)-2-methylpent-1-en-3-yl] (3S,6R,7S,8S)-3,7,12-trihydroxy-4,4,6,8,12-pentamethyl-5-oxotridecanoate |
| SMILES | CC[C@H](OC(=O)C[C@H](O)C(C)(C)C(=O)[C@H](C)[C@@H](O)[C@@H](C)CCCC(C)(C)O)/C(C)=C/c1nc(Cl)c2ncn(C)c2n1 |
| InChI | InChI=1S/C30H47ClN4O6/c1-10-20(18(3)14-22-33-27(31)24-28(34-22)35(9)16-32-24)41-23(37)15-21(36)30(7,8)26(39)19(4)25(38)17(2)12-11-13-29(5,6)40/h14,16-17,19-21,25,36,38,40H,10-13,15H2,1-9H3/b18-14+/t17-,19+,20-,21-,25-/m0/s1 |
| InChIKey | FLHINQUZUWLHCL-LNGCDEQDSA-N |
| XLogP | 4.66 |
| TPSA | 147.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.18 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |