C23H39NO6 — CID 89361513
(1S,3S,7S,10R,11S,12S,16R)-3-[(E)-1-aminoprop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione (PubChem CID 89361513) has the molecular formula C23H39NO6 and a molecular weight of 425.57 g/mol. Its IUPAC name is (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-1-aminoprop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione.
| Compound Name | (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-1-aminoprop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
|---|---|
| PubChem CID | 89361513 |
| Molecular Formula | C23H39NO6 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (1S,3S,7S,10R,11S,12S,16R)-3-[(E)-1-aminoprop-1-en-2-yl]-7,11-dihydroxy-8,8,10,12,16-pentamethyl-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
| SMILES | C/C(=C\N)[C@@H]1C[C@@H]2O[C@]2(C)CCC[C@H](C)[C@H](O)[C@@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O1 |
| InChI | InChI=1S/C23H39NO6/c1-13-8-7-9-23(6)18(30-23)10-16(14(2)12-24)29-19(26)11-17(25)22(4,5)21(28)15(3)20(13)27/h12-13,15-18,20,25,27H,7-11,24H2,1-6H3/b14-12+/t13-,15+,16-,17-,18-,20-,23+/m0/s1 |
| InChIKey | GVPHCKWIBWLVPB-JAQFTHSQSA-N |
| XLogP | 2.47 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|