C27H36N2O6S — CID 89361595
1-[(1R,3R,4S)-7-butoxy-1-(butoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-3-(4-methylbenzoyl)-2-sulfanylidenepyrimidin-4-one (PubChem CID 89361595) has the molecular formula C27H36N2O6S and a molecular weight of 516.66 g/mol. Its IUPAC name is 1-[(1R,3R,4S)-7-butoxy-1-(butoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-3-(4-methylbenzoyl)-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(1R,3R,4S)-7-butoxy-1-(butoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-3-(4-methylbenzoyl)-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 89361595 |
| Molecular Formula | C27H36N2O6S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | 1-[(1R,3R,4S)-7-butoxy-1-(butoxymethyl)-2,5-dioxabicyclo[2.2.1]heptan-3-yl]-5-methyl-3-(4-methylbenzoyl)-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCCCOC[C@@]12CO[C@@H](C1OCCCC)[C@H](n1cc(C)c(=O)n(C(=O)c3ccc(C)cc3)c1=S)O2 |
| InChI | InChI=1S/C27H36N2O6S/c1-5-7-13-32-16-27-17-34-21(22(27)33-14-8-6-2)25(35-27)28-15-19(4)23(30)29(26(28)36)24(31)20-11-9-18(3)10-12-20/h9-12,15,21-22,25H,5-8,13-14,16-17H2,1-4H3/t21-,22?,25+,27+/m0/s1 |
| InChIKey | IZVANHNOIYPAQJ-GTZUYRIWSA-N |
| XLogP | 4.35 |
| TPSA | 80.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|