About 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol
3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol (PubChem CID 89361635) has the molecular formula C10H10ClN3O
and a molecular weight of 223.66 g/mol. Its IUPAC name is 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol.
Molecular Properties
| Compound Name | 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol |
| PubChem CID | 89361635 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol |
| SMILES | OC1CC(c2ncc3c(Cl)nccn23)C1 |
| InChI | InChI=1S/C10H10ClN3O/c11-9-8-5-13-10(6-3-7(15)4-6)14(8)2-1-12-9/h1-2,5-7,15H,3-4H2 |
| InChIKey | STOFCFFMJYATSU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol?
The IUPAC name of 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol (CID 89361635) is 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol.
What is the SMILES notation for 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol?
The canonical SMILES for 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol is OC1CC(c2ncc3c(Cl)nccn23)C1.
What is the InChIKey of 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol?
The InChIKey is STOFCFFMJYATSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O/c11-9-8-5-13-10(6-3-7(15)4-6)14(8)2-1-12-9/h1-2,5-7,15H,3-4H2.
What are the key properties of 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol?
3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol has a molecular weight of 223.66 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(8-chloroimidazo[1,5-a]pyrazin-3-yl)cyclobutan-1-ol is sourced from PubChem (CID 89361635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).