About 4-chloro-N,N-dihydroxyquinazolin-6-amine
4-chloro-N,N-dihydroxyquinazolin-6-amine (PubChem CID 89361818) has the molecular formula C8H6ClN3O2
and a molecular weight of 211.61 g/mol. Its IUPAC name is 4-chloro-N,N-dihydroxyquinazolin-6-amine.
Molecular Properties
| Compound Name | 4-chloro-N,N-dihydroxyquinazolin-6-amine |
| PubChem CID | 89361818 |
| Molecular Formula | C8H6ClN3O2 |
| Molecular Weight | 211.61 g/mol |
| Exact Mass | 211.01 |
| IUPAC Name | 4-chloro-N,N-dihydroxyquinazolin-6-amine |
| SMILES | ON(O)c1ccc2ncnc(Cl)c2c1 |
| InChI | InChI=1S/C8H6ClN3O2/c9-8-6-3-5(12(13)14)1-2-7(6)10-4-11-8/h1-4,13-14H |
| InChIKey | UXTDASRRSHSCBF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.61 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N,N-dihydroxyquinazolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N,N-dihydroxyquinazolin-6-amine?
The IUPAC name of 4-chloro-N,N-dihydroxyquinazolin-6-amine (CID 89361818) is 4-chloro-N,N-dihydroxyquinazolin-6-amine.
What is the SMILES notation for 4-chloro-N,N-dihydroxyquinazolin-6-amine?
The canonical SMILES for 4-chloro-N,N-dihydroxyquinazolin-6-amine is ON(O)c1ccc2ncnc(Cl)c2c1.
What is the InChIKey of 4-chloro-N,N-dihydroxyquinazolin-6-amine?
The InChIKey is UXTDASRRSHSCBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClN3O2/c9-8-6-3-5(12(13)14)1-2-7(6)10-4-11-8/h1-4,13-14H.
What are the key properties of 4-chloro-N,N-dihydroxyquinazolin-6-amine?
4-chloro-N,N-dihydroxyquinazolin-6-amine has a molecular weight of 211.61 g/mol, XLogP of 1.87, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N,N-dihydroxyquinazolin-6-amine is sourced from PubChem (CID 89361818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).