C28H26F3NO5 — CID 89362071
5-[4-amino-3-(trifluoromethyl)phenyl]-2-[(3Z,5Z)-6-hydroxy-5-phenylmethoxyhexa-1,3,5-trien-2-yl]-3,6-dimethoxyphenol (PubChem CID 89362071) has the molecular formula C28H26F3NO5 and a molecular weight of 513.51 g/mol. Its IUPAC name is 5-[4-amino-3-(trifluoromethyl)phenyl]-2-[(3Z,5Z)-6-hydroxy-5-phenylmethoxyhexa-1,3,5-trien-2-yl]-3,6-dimethoxyphenol.
| Compound Name | 5-[4-amino-3-(trifluoromethyl)phenyl]-2-[(3Z,5Z)-6-hydroxy-5-phenylmethoxyhexa-1,3,5-trien-2-yl]-3,6-dimethoxyphenol |
|---|---|
| PubChem CID | 89362071 |
| Molecular Formula | C28H26F3NO5 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | 5-[4-amino-3-(trifluoromethyl)phenyl]-2-[(3Z,5Z)-6-hydroxy-5-phenylmethoxyhexa-1,3,5-trien-2-yl]-3,6-dimethoxyphenol |
| SMILES | C=C(/C=C\C(=C\O)OCc1ccccc1)c1c(OC)cc(-c2ccc(N)c(C(F)(F)F)c2)c(OC)c1O |
| InChI | InChI=1S/C28H26F3NO5/c1-17(9-11-20(15-33)37-16-18-7-5-4-6-8-18)25-24(35-2)14-21(27(36-3)26(25)34)19-10-12-23(32)22(13-19)28(29,30)31/h4-15,33-34H,1,16,32H2,2-3H3/b11-9-,20-15- |
| InChIKey | ZPAZLXGAEYDOOO-LTRZPEHKSA-N |
| XLogP | 6.86 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|