C18H16FNO3 — CID 893621
3-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)pyrrol-2-yl]propanoic acid (PubChem CID 893621) has the molecular formula C18H16FNO3 and a molecular weight of 313.33 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)pyrrol-2-yl]propanoic acid.
| Compound Name | 3-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)pyrrol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 893621 |
| Molecular Formula | C18H16FNO3 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-1-(furan-2-ylmethyl)pyrrol-2-yl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(-c2ccc(F)cc2)n1Cc1ccco1 |
| InChI | InChI=1S/C18H16FNO3/c19-14-5-3-13(4-6-14)17-9-7-15(8-10-18(21)22)20(17)12-16-2-1-11-23-16/h1-7,9,11H,8,10,12H2,(H,21,22) |
| InChIKey | JPHMJMCBMUYUOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|