About (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol
(4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol (PubChem CID 89362308) has the molecular formula C8H11FO
and a molecular weight of 142.17 g/mol. Its IUPAC name is (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol.
Molecular Properties
| Compound Name | (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol |
| PubChem CID | 89362308 |
| Molecular Formula | C8H11FO |
| Molecular Weight | 142.17 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol |
| SMILES | CC1C=C(O)C(F)=C[C@H]1C |
| InChI | InChI=1S/C8H11FO/c1-5-3-7(9)8(10)4-6(5)2/h3-6,10H,1-2H3/t5-,6?/m1/s1 |
| InChIKey | IMTJIBANIOHVTL-LWOQYNTDSA-N |
| XLogP | 2.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.17 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol?
The IUPAC name of (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol (CID 89362308) is (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol.
What is the SMILES notation for (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol?
The canonical SMILES for (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol is CC1C=C(O)C(F)=C[C@H]1C.
What is the InChIKey of (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol?
The InChIKey is IMTJIBANIOHVTL-LWOQYNTDSA-N. The full InChI is InChI=1S/C8H11FO/c1-5-3-7(9)8(10)4-6(5)2/h3-6,10H,1-2H3/t5-,6?/m1/s1.
What are the key properties of (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol?
(4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol has a molecular weight of 142.17 g/mol, XLogP of 2.57, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6-fluoro-3,4-dimethylcyclohexa-1,5-dien-1-ol is sourced from PubChem (CID 89362308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).