About (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde
(4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 89362390) has the molecular formula C8H10O
and a molecular weight of 122.17 g/mol. Its IUPAC name is (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 89362390 |
| Molecular Formula | C8H10O |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.07 |
| IUPAC Name | (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | C[C@H]1C=CC(C=O)=CC1 |
| InChI | InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2,4-7H,3H2,1H3/t7-/m0/s1 |
| InChIKey | AOHWWLOSGOHUOT-ZETCQYMHSA-N |
| XLogP | 1.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde (CID 89362390) is (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde is C[C@H]1C=CC(C=O)=CC1.
What is the InChIKey of (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is AOHWWLOSGOHUOT-ZETCQYMHSA-N. The full InChI is InChI=1S/C8H10O/c1-7-2-4-8(6-9)5-3-7/h2,4-7H,3H2,1H3/t7-/m0/s1.
What are the key properties of (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde?
(4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 122.17 g/mol, XLogP of 1.71, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-methylcyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 89362390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).