C14H6O6 — CID 89362654
4,10-dihydro-[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone (PubChem CID 89362654) has the molecular formula C14H6O6 and a molecular weight of 270.20 g/mol. Its IUPAC name is 4,10-dihydro-[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone.
| Compound Name | 4,10-dihydro-[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone |
|---|---|
| PubChem CID | 89362654 |
| Molecular Formula | C14H6O6 |
| Molecular Weight | 270.20 g/mol |
| Exact Mass | 270.02 |
| IUPAC Name | 4,10-dihydro-[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone |
| SMILES | O=C1OC(=O)C2=C1Cc1cc3c(cc1C2)C(=O)OC3=O |
| InChI | InChI=1S/C14H6O6/c15-11-7-1-5-2-9-10(14(18)20-13(9)17)4-6(5)3-8(7)12(16)19-11/h1,3H,2,4H2 |
| InChIKey | YYUCICQYILYZJD-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.20 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|