C25H35N5 — CID 89362760
2-[(E)-3-(3,4-dimethylphenyl)prop-2-enimidoyl]-5-(4-methylpiperazin-1-yl)-4-N-propylbenzene-1,4-diamine (PubChem CID 89362760) has the molecular formula C25H35N5 and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-[(E)-3-(3,4-dimethylphenyl)prop-2-enimidoyl]-5-(4-methylpiperazin-1-yl)-4-N-propylbenzene-1,4-diamine.
| Compound Name | 2-[(E)-3-(3,4-dimethylphenyl)prop-2-enimidoyl]-5-(4-methylpiperazin-1-yl)-4-N-propylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 89362760 |
| Molecular Formula | C25H35N5 |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.29 |
| IUPAC Name | 2-[(E)-3-(3,4-dimethylphenyl)prop-2-enimidoyl]-5-(4-methylpiperazin-1-yl)-4-N-propylbenzene-1,4-diamine |
| SMILES | [H]/N=C(\C=C\c1ccc(C)c(C)c1)c1cc(NCCC)c(N2CCN(C)CC2)cc1N |
| InChI | InChI=1S/C25H35N5/c1-5-10-28-24-16-21(22(26)9-8-20-7-6-18(2)19(3)15-20)23(27)17-25(24)30-13-11-29(4)12-14-30/h6-9,15-17,26,28H,5,10-14,27H2,1-4H3/b9-8+,26-22+ |
| InChIKey | PHYZLGWGORCODJ-WYTWLMCTSA-N |
| XLogP | 4.54 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|