About (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal
(2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal (PubChem CID 89362926) has the molecular formula C13H20O3
and a molecular weight of 224.30 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal.
Molecular Properties
| Compound Name | (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal |
| PubChem CID | 89362926 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal |
| SMILES | C=C(/C=C\C(C=O)=C/C)OCCC(C)OC |
| InChI | InChI=1S/C13H20O3/c1-5-13(10-14)7-6-12(3)16-9-8-11(2)15-4/h5-7,10-11H,3,8-9H2,1-2,4H3/b7-6-,13-5+ |
| InChIKey | SKXTWZHHAHQVOK-ZQNRWWJISA-N |
| XLogP | 2.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal?
The IUPAC name of (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal (CID 89362926) is (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal.
What is the SMILES notation for (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal?
The canonical SMILES for (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal is C=C(/C=C\C(C=O)=C/C)OCCC(C)OC.
What is the InChIKey of (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal?
The InChIKey is SKXTWZHHAHQVOK-ZQNRWWJISA-N. The full InChI is InChI=1S/C13H20O3/c1-5-13(10-14)7-6-12(3)16-9-8-11(2)15-4/h5-7,10-11H,3,8-9H2,1-2,4H3/b7-6-,13-5+.
What are the key properties of (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal?
(2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal has a molecular weight of 224.30 g/mol, XLogP of 2.64, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2-ethylidene-5-(3-methoxybutoxy)hexa-3,5-dienal is sourced from PubChem (CID 89362926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).