C16H17N5O — CID 893630
1-(3,4-dimethylphenyl)-3-(1-methylbenzotriazol-5-yl)urea (PubChem CID 893630) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-3-(1-methylbenzotriazol-5-yl)urea.
| Compound Name | 1-(3,4-dimethylphenyl)-3-(1-methylbenzotriazol-5-yl)urea |
|---|---|
| PubChem CID | 893630 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-3-(1-methylbenzotriazol-5-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nc2ccc3c(c2)nnn3C)cc1C |
| InChI | InChI=1S/C16H17N5O/c1-10-4-5-12(8-11(10)2)17-16(22)18-13-6-7-15-14(9-13)19-20-21(15)3/h4-9H,1-3H3,(H2,17,18,22) |
| InChIKey | WGKUNKPKNGMEEF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |