About N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide
N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 89363295) has the molecular formula C8H10FNO
and a molecular weight of 155.17 g/mol. Its IUPAC name is N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 89363295 |
| Molecular Formula | C8H10FNO |
| Molecular Weight | 155.17 g/mol |
| Exact Mass | 155.07 |
| IUPAC Name | N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(F)CC=C1 |
| InChI | InChI=1S/C8H10FNO/c1-6(11)10-8-4-2-3-7(9)5-8/h2,4-5,7H,3H2,1H3,(H,10,11) |
| InChIKey | FZUIJDGUEVMUFV-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.17 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide (CID 89363295) is N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CC(F)CC=C1.
What is the InChIKey of N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is FZUIJDGUEVMUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO/c1-6(11)10-8-4-2-3-7(9)5-8/h2,4-5,7H,3H2,1H3,(H,10,11).
What are the key properties of N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide?
N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 155.17 g/mol, XLogP of 1.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-fluorocyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 89363295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).