C15H20N2 — CID 89363364
[(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]diazene (PubChem CID 89363364) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]diazene.
| Compound Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]diazene |
|---|---|
| PubChem CID | 89363364 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | [(2E,4Z)-hepta-2,4,6-trien-3-yl]-[(2Z,4E,6E)-octa-2,4,6-trien-4-yl]diazene |
| SMILES | C=C/C=C\C(=C/C)\N=N\C(\C=C/C)=C\C=C\C |
| InChI | InChI=1S/C15H20N2/c1-5-9-12-14(8-4)16-17-15(11-7-3)13-10-6-2/h5-13H,1H2,2-4H3/b10-6+,11-7-,12-9-,14-8+,15-13+,17-16+ |
| InChIKey | XQIWEDVEZGFLLM-FOBNFSQOSA-N |
| XLogP | 5.12 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|