C26H36IN7O4S — CID 89363818
1-[4-(iodomethyl)phenyl]-3-[(2S)-3-(2-methoxyethylsulfanyl)-3-methyl-1-[4-(3-methyl-5-oxo-7H-imidazo[1,5-c]imidazol-6-yl)piperazin-1-yl]-1-oxobutan-2-yl]urea (PubChem CID 89363818) has the molecular formula C26H36IN7O4S and a molecular weight of 669.59 g/mol. Its IUPAC name is 1-[4-(iodomethyl)phenyl]-3-[(2S)-3-(2-methoxyethylsulfanyl)-3-methyl-1-[4-(3-methyl-5-oxo-7H-imidazo[1,5-c]imidazol-6-yl)piperazin-1-yl]-1-oxobutan-2-yl]urea.
| Compound Name | 1-[4-(iodomethyl)phenyl]-3-[(2S)-3-(2-methoxyethylsulfanyl)-3-methyl-1-[4-(3-methyl-5-oxo-7H-imidazo[1,5-c]imidazol-6-yl)piperazin-1-yl]-1-oxobutan-2-yl]urea |
|---|---|
| PubChem CID | 89363818 |
| Molecular Formula | C26H36IN7O4S |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | 1-[4-(iodomethyl)phenyl]-3-[(2S)-3-(2-methoxyethylsulfanyl)-3-methyl-1-[4-(3-methyl-5-oxo-7H-imidazo[1,5-c]imidazol-6-yl)piperazin-1-yl]-1-oxobutan-2-yl]urea |
| SMILES | COCCSC(C)(C)[C@@H](NC(=O)Nc1ccc(CI)cc1)C(=O)N1CCN(N2Cc3cnc(C)n3C2=O)CC1 |
| InChI | InChI=1S/C26H36IN7O4S/c1-18-28-16-21-17-33(25(37)34(18)21)32-11-9-31(10-12-32)23(35)22(26(2,3)39-14-13-38-4)30-24(36)29-20-7-5-19(15-27)6-8-20/h5-8,16,22H,9-15,17H2,1-4H3,(H2,29,30,36)/t22-/m0/s1 |
| InChIKey | BYLNJUTXMPUCEN-QFIPXVFZSA-N |
| XLogP | 3.32 |
| TPSA | 112.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|