C13H21N — CID 89363927
4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine (PubChem CID 89363927) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine.
| Compound Name | 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 89363927 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | 4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
| SMILES | C=C(/C=C\C=C/C)C1CCN(C)CC1 |
| InChI | InChI=1S/C13H21N/c1-4-5-6-7-12(2)13-8-10-14(3)11-9-13/h4-7,13H,2,8-11H2,1,3H3/b5-4-,7-6- |
| InChIKey | ZKBJOAUFJIESHU-RZSVFLSASA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|