About 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde
3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde (PubChem CID 89364014) has the molecular formula C17H16O3
and a molecular weight of 268.31 g/mol. Its IUPAC name is 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde.
Molecular Properties
| Compound Name | 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde |
| PubChem CID | 89364014 |
| Molecular Formula | C17H16O3 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde |
| SMILES | COC1=C(OC)C2=c3ccccc3=CCC2C(C=O)=C1 |
| InChI | InChI=1S/C17H16O3/c1-19-15-9-12(10-18)14-8-7-11-5-3-4-6-13(11)16(14)17(15)20-2/h3-7,9-10,14H,8H2,1-2H3 |
| InChIKey | DXOHKYMBTLOLMK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde?
The IUPAC name of 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde (CID 89364014) is 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde.
What is the SMILES notation for 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde?
The canonical SMILES for 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde is COC1=C(OC)C2=c3ccccc3=CCC2C(C=O)=C1.
What is the InChIKey of 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde?
The InChIKey is DXOHKYMBTLOLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16O3/c1-19-15-9-12(10-18)14-8-7-11-5-3-4-6-13(11)16(14)17(15)20-2/h3-7,9-10,14H,8H2,1-2H3.
What are the key properties of 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde?
3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde has a molecular weight of 268.31 g/mol, XLogP of 1.28, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-10,10a-dihydrophenanthrene-1-carbaldehyde is sourced from PubChem (CID 89364014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).