C37H32N2 — CID 89364331
2-[10-[(1Z,3E)-1-[(1R)-2-methylcyclobutyl]penta-1,3-dien-3-yl]anthracen-9-yl]-1-phenylbenzimidazole (PubChem CID 89364331) has the molecular formula C37H32N2 and a molecular weight of 504.68 g/mol. Its IUPAC name is 2-[10-[(1Z,3E)-1-[(1R)-2-methylcyclobutyl]penta-1,3-dien-3-yl]anthracen-9-yl]-1-phenylbenzimidazole.
| Compound Name | 2-[10-[(1Z,3E)-1-[(1R)-2-methylcyclobutyl]penta-1,3-dien-3-yl]anthracen-9-yl]-1-phenylbenzimidazole |
|---|---|
| PubChem CID | 89364331 |
| Molecular Formula | C37H32N2 |
| Molecular Weight | 504.68 g/mol |
| Exact Mass | 504.26 |
| IUPAC Name | 2-[10-[(1Z,3E)-1-[(1R)-2-methylcyclobutyl]penta-1,3-dien-3-yl]anthracen-9-yl]-1-phenylbenzimidazole |
| SMILES | C/C=C(\C=C/[C@@H]1CCC1C)c1c2ccccc2c(-c2nc3ccccc3n2-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C37H32N2/c1-3-26(23-24-27-22-21-25(27)2)35-29-15-7-9-17-31(29)36(32-18-10-8-16-30(32)35)37-38-33-19-11-12-20-34(33)39(37)28-13-5-4-6-14-28/h3-20,23-25,27H,21-22H2,1-2H3/b24-23-,26-3+/t25?,27-/m0/s1 |
| InChIKey | WSMNFSCJPQIXTQ-IZIHOPDISA-N |
| XLogP | 10.00 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.68 |
| LogP ≤ 5 | 10.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|