C11H20N2 — CID 89364339
(1Z,3Z)-5-methylidene-N'-propylhepta-1,3-diene-1,7-diamine (PubChem CID 89364339) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is (1Z,3Z)-5-methylidene-N'-propylhepta-1,3-diene-1,7-diamine.
| Compound Name | (1Z,3Z)-5-methylidene-N'-propylhepta-1,3-diene-1,7-diamine |
|---|---|
| PubChem CID | 89364339 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | (1Z,3Z)-5-methylidene-N'-propylhepta-1,3-diene-1,7-diamine |
| SMILES | C=C(/C=C\C=C/N)CCNCCC |
| InChI | InChI=1S/C11H20N2/c1-3-9-13-10-7-11(2)6-4-5-8-12/h4-6,8,13H,2-3,7,9-10,12H2,1H3/b6-4-,8-5- |
| InChIKey | FFHUHOGJQAMWQM-VXWIUBPCSA-N |
| XLogP | 1.96 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|