C31H25F3O3S — CID 89364421
[5-[10-(1,8a-dihydronaphthalen-2-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate (PubChem CID 89364421) has the molecular formula C31H25F3O3S and a molecular weight of 534.60 g/mol. Its IUPAC name is [5-[10-(1,8a-dihydronaphthalen-2-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate.
| Compound Name | [5-[10-(1,8a-dihydronaphthalen-2-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89364421 |
| Molecular Formula | C31H25F3O3S |
| Molecular Weight | 534.60 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | [5-[10-(1,8a-dihydronaphthalen-2-yl)-2,3-dihydroanthracen-9-yl]cyclohexa-2,4-dien-1-yl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC1C=CC=C(c2c3c(c(C4=CC=C5C=CC=CC5C4)c4ccccc24)=CCCC=3)C1)C(F)(F)F |
| InChI | InChI=1S/C31H25F3O3S/c32-31(33,34)38(35,36)37-24-11-7-10-22(19-24)29-25-12-3-5-14-27(25)30(28-15-6-4-13-26(28)29)23-17-16-20-8-1-2-9-21(20)18-23/h1-3,5,7-17,21,24H,4,6,18-19H2 |
| InChIKey | ICOXQXJRGDWURV-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.60 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|