About 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate
2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate (PubChem CID 89364489) has the molecular formula C20H34O6
and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate.
Molecular Properties
| Compound Name | 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate |
| PubChem CID | 89364489 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate |
| SMILES | CC(C)COC(=O)OC(=O)[C@@H](C[C@@H](C)[C@@H]1C[C@@H](C(C)C)C(=O)O1)C(C)C |
| InChI | InChI=1S/C20H34O6/c1-11(2)10-24-20(23)26-19(22)15(12(3)4)8-14(7)17-9-16(13(5)6)18(21)25-17/h11-17H,8-10H2,1-7H3/t14-,15+,16+,17+/m1/s1 |
| InChIKey | QLXLNOOZVBGJLK-QZWWFDLISA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate?
The IUPAC name of 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate (CID 89364489) is 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate.
What is the SMILES notation for 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate?
The canonical SMILES for 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate is CC(C)COC(=O)OC(=O)[C@@H](C[C@@H](C)[C@@H]1C[C@@H](C(C)C)C(=O)O1)C(C)C.
What is the InChIKey of 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate?
The InChIKey is QLXLNOOZVBGJLK-QZWWFDLISA-N. The full InChI is InChI=1S/C20H34O6/c1-11(2)10-24-20(23)26-19(22)15(12(3)4)8-14(7)17-9-16(13(5)6)18(21)25-17/h11-17H,8-10H2,1-7H3/t14-,15+,16+,17+/m1/s1.
What are the key properties of 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate?
2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate has a molecular weight of 370.49 g/mol, XLogP of 4.21, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropoxycarbonyl (2S,4R)-4-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]-2-propan-2-ylpentanoate is sourced from PubChem (CID 89364489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).