C17H40N6O — CID 89364495
(2S)-2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylhexanamide (PubChem CID 89364495) has the molecular formula C17H40N6O and a molecular weight of 344.55 g/mol. Its IUPAC name is (2S)-2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylhexanamide.
| Compound Name | (2S)-2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 89364495 |
| Molecular Formula | C17H40N6O |
| Molecular Weight | 344.55 g/mol |
| Exact Mass | 344.33 |
| IUPAC Name | (2S)-2,6-diamino-N-[3-[4-(3-aminopropylamino)butylamino]propyl]-2-methylhexanamide |
| SMILES | C[C@](N)(CCCCN)C(=O)NCCCNCCCCNCCCN |
| InChI | InChI=1S/C17H40N6O/c1-17(20,8-2-3-9-18)16(24)23-15-7-14-22-12-5-4-11-21-13-6-10-19/h21-22H,2-15,18-20H2,1H3,(H,23,24)/t17-/m0/s1 |
| InChIKey | BMHGEDYLQNNFDF-KRWDZBQOSA-N |
| XLogP | -0.35 |
| TPSA | 131.22 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.55 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|