About 7-butan-2-yl-8,9-dihydropurine
7-butan-2-yl-8,9-dihydropurine (PubChem CID 89364647) has the molecular formula C9H14N4
and a molecular weight of 178.24 g/mol. Its IUPAC name is 7-butan-2-yl-8,9-dihydropurine.
Molecular Properties
| Compound Name | 7-butan-2-yl-8,9-dihydropurine |
| PubChem CID | 89364647 |
| Molecular Formula | C9H14N4 |
| Molecular Weight | 178.24 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 7-butan-2-yl-8,9-dihydropurine |
| SMILES | CCC(C)N1CNc2ncncc21 |
| InChI | InChI=1S/C9H14N4/c1-3-7(2)13-6-12-9-8(13)4-10-5-11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11,12) |
| InChIKey | VDDKSODVINEFOG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.24 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-butan-2-yl-8,9-dihydropurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-butan-2-yl-8,9-dihydropurine?
The IUPAC name of 7-butan-2-yl-8,9-dihydropurine (CID 89364647) is 7-butan-2-yl-8,9-dihydropurine.
What is the SMILES notation for 7-butan-2-yl-8,9-dihydropurine?
The canonical SMILES for 7-butan-2-yl-8,9-dihydropurine is CCC(C)N1CNc2ncncc21.
What is the InChIKey of 7-butan-2-yl-8,9-dihydropurine?
The InChIKey is VDDKSODVINEFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4/c1-3-7(2)13-6-12-9-8(13)4-10-5-11-9/h4-5,7H,3,6H2,1-2H3,(H,10,11,12).
What are the key properties of 7-butan-2-yl-8,9-dihydropurine?
7-butan-2-yl-8,9-dihydropurine has a molecular weight of 178.24 g/mol, XLogP of 1.46, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butan-2-yl-8,9-dihydropurine is sourced from PubChem (CID 89364647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).