About [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate
[1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate (PubChem CID 89364818) has the molecular formula C17H20ClFN2O2
and a molecular weight of 338.81 g/mol. Its IUPAC name is [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate |
| PubChem CID | 89364818 |
| Molecular Formula | C17H20ClFN2O2 |
| Molecular Weight | 338.81 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate |
| SMILES | CCCc1cc(OC(=O)C(C)(C)CCl)n(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C17H20ClFN2O2/c1-4-6-13-10-15(23-16(22)17(2,3)11-18)21(20-13)14-8-5-7-12(19)9-14/h5,7-10H,4,6,11H2,1-3H3 |
| InChIKey | ARYAWVUVIZPAQA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate?
The IUPAC name of [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate (CID 89364818) is [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate.
What is the SMILES notation for [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate?
The canonical SMILES for [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate is CCCc1cc(OC(=O)C(C)(C)CCl)n(-c2cccc(F)c2)n1.
What is the InChIKey of [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate?
The InChIKey is ARYAWVUVIZPAQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20ClFN2O2/c1-4-6-13-10-15(23-16(22)17(2,3)11-18)21(20-13)14-8-5-7-12(19)9-14/h5,7-10H,4,6,11H2,1-3H3.
What are the key properties of [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate?
[1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate has a molecular weight of 338.81 g/mol, XLogP of 4.13, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3-fluorophenyl)-3-propylpyrazol-5-yl] 3-chloro-2,2-dimethylpropanoate is sourced from PubChem (CID 89364818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).