C15H20F6O3 — CID 89364893
(5S)-5-[3,3,3-trifluoro-2-(2-methoxypropoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene (PubChem CID 89364893) has the molecular formula C15H20F6O3 and a molecular weight of 362.31 g/mol. Its IUPAC name is (5S)-5-[3,3,3-trifluoro-2-(2-methoxypropoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene.
| Compound Name | (5S)-5-[3,3,3-trifluoro-2-(2-methoxypropoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 89364893 |
| Molecular Formula | C15H20F6O3 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | (5S)-5-[3,3,3-trifluoro-2-(2-methoxypropoxy)-2-(trifluoromethyl)propoxy]bicyclo[2.2.1]hept-2-ene |
| SMILES | COC(C)COC(CO[C@H]1CC2C=CC1C2)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H20F6O3/c1-9(22-2)7-24-13(14(16,17)18,15(19,20)21)8-23-12-6-10-3-4-11(12)5-10/h3-4,9-12H,5-8H2,1-2H3/t9?,10?,11?,12-/m0/s1 |
| InChIKey | MYXWYKDBHSHGPO-ROAFRPBMSA-N |
| XLogP | 3.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|