C6H15NO3 — CID 89364894
(2R,3S,4R)-2-aminohexane-1,3,4-triol (PubChem CID 89364894) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is (2R,3S,4R)-2-aminohexane-1,3,4-triol.
| Compound Name | (2R,3S,4R)-2-aminohexane-1,3,4-triol |
|---|---|
| PubChem CID | 89364894 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | (2R,3S,4R)-2-aminohexane-1,3,4-triol |
| SMILES | CC[C@@H](O)[C@@H](O)[C@H](N)CO |
| InChI | InChI=1S/C6H15NO3/c1-2-5(9)6(10)4(7)3-8/h4-6,8-10H,2-3,7H2,1H3/t4-,5-,6+/m1/s1 |
| InChIKey | ULVFNIHYRKSRPH-PBXRRBTRSA-N |
| XLogP | -1.56 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |