About propan-2-yl methanimidothioate
propan-2-yl methanimidothioate (PubChem CID 89365201) has the molecular formula C4H9NS
and a molecular weight of 103.19 g/mol. Its IUPAC name is propan-2-yl methanimidothioate.
Molecular Properties
| Compound Name | propan-2-yl methanimidothioate |
| PubChem CID | 89365201 |
| Molecular Formula | C4H9NS |
| Molecular Weight | 103.19 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | propan-2-yl methanimidothioate |
| SMILES | [H]/N=C/SC(C)C |
| InChI | InChI=1S/C4H9NS/c1-4(2)6-3-5/h3-5H,1-2H3/b5-3+ |
| InChIKey | KAIAXARKENBDEM-HWKANZROSA-N |
| XLogP | 1.74 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.19 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze propan-2-yl methanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl methanimidothioate?
The IUPAC name of propan-2-yl methanimidothioate (CID 89365201) is propan-2-yl methanimidothioate.
What is the SMILES notation for propan-2-yl methanimidothioate?
The canonical SMILES for propan-2-yl methanimidothioate is [H]/N=C/SC(C)C.
What is the InChIKey of propan-2-yl methanimidothioate?
The InChIKey is KAIAXARKENBDEM-HWKANZROSA-N. The full InChI is InChI=1S/C4H9NS/c1-4(2)6-3-5/h3-5H,1-2H3/b5-3+.
What are the key properties of propan-2-yl methanimidothioate?
propan-2-yl methanimidothioate has a molecular weight of 103.19 g/mol, XLogP of 1.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl methanimidothioate is sourced from PubChem (CID 89365201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).