About 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene
1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene (PubChem CID 89365375) has the molecular formula C24H42O6P2
and a molecular weight of 488.54 g/mol. Its IUPAC name is 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene.
Molecular Properties
| Compound Name | 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene |
| PubChem CID | 89365375 |
| Molecular Formula | C24H42O6P2 |
| Molecular Weight | 488.54 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene |
| SMILES | CCOP(=O)(OCC)C(=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C24H42O6P2/c1-11-27-31(25,28-12-2)22(32(26,29-13-3)30-14-4)17-19-15-20(23(5,6)7)18-21(16-19)24(8,9)10/h15-18H,11-14H2,1-10H3 |
| InChIKey | XVMWELNRLBAKPF-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 488.54 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene?
The IUPAC name of 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene (CID 89365375) is 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene.
What is the SMILES notation for 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene?
The canonical SMILES for 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene is CCOP(=O)(OCC)C(=Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1)P(=O)(OCC)OCC.
What is the InChIKey of 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene?
The InChIKey is XVMWELNRLBAKPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O6P2/c1-11-27-31(25,28-12-2)22(32(26,29-13-3)30-14-4)17-19-15-20(23(5,6)7)18-21(16-19)24(8,9)10/h15-18H,11-14H2,1-10H3.
What are the key properties of 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene?
1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene has a molecular weight of 488.54 g/mol, XLogP of 8.11, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,2-bis(diethoxyphosphoryl)ethenyl]-3,5-ditert-butylbenzene is sourced from PubChem (CID 89365375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).